C33H63O10P — CID 138191780
[1-hydroxy-3-[hydroxy-(3-hydroxy-2-undecanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate (PubChem CID 138191780) has the molecular formula C33H63O10P and a molecular weight of 650.83 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-(3-hydroxy-2-undecanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate.
| Compound Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-undecanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138191780 |
| Molecular Formula | C33H63O10P |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-undecanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C33H63O10P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-33(37)43-31(27-35)29-41-44(38,39)40-28-30(26-34)42-32(36)24-22-20-18-12-10-8-6-4-2/h13-14,30-31,34-35H,3-12,15-29H2,1-2H3,(H,38,39)/b14-13- |
| InChIKey | KBOPODOPRCNRQW-YPKPFQOOSA-N |
| XLogP | 7.72 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|