C32H61O10P — CID 138172645
[1-[(2-decanoyloxy-3-hydroxypropoxy)-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (Z)-hexadec-9-enoate (PubChem CID 138172645) has the molecular formula C32H61O10P and a molecular weight of 636.80 g/mol. Its IUPAC name is [1-[(2-decanoyloxy-3-hydroxypropoxy)-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (Z)-hexadec-9-enoate.
| Compound Name | [1-[(2-decanoyloxy-3-hydroxypropoxy)-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138172645 |
| Molecular Formula | C32H61O10P |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | [1-[(2-decanoyloxy-3-hydroxypropoxy)-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C32H61O10P/c1-3-5-7-9-11-12-13-14-15-16-18-20-22-24-32(36)42-30(26-34)28-40-43(37,38)39-27-29(25-33)41-31(35)23-21-19-17-10-8-6-4-2/h12-13,29-30,33-34H,3-11,14-28H2,1-2H3,(H,37,38)/b13-12- |
| InChIKey | HUMLOYNBKMLHFW-SEYXRHQNSA-N |
| XLogP | 7.33 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|