C17H20N4O5S — CID 1330
4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid (PubChem CID 1330) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid.
| Compound Name | 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 1330 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)benzenesulfonic acid |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(S(=O)(=O)O)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H20N4O5S/c1-3-9-20-15-13(16(22)21(10-4-2)17(20)23)18-14(19-15)11-5-7-12(8-6-11)27(24,25)26/h5-8H,3-4,9-10H2,1-2H3,(H,18,19)(H,24,25,26) |
| InChIKey | IWALGNIFYOBRKC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|