C24H46N4O2 — CID 13300490
1-methyl-N-[10-[(1-methylpiperidine-3-carbonyl)amino]decyl]piperidine-3-carboxamide (PubChem CID 13300490) has the molecular formula C24H46N4O2 and a molecular weight of 422.66 g/mol. Its IUPAC name is 1-methyl-N-[10-[(1-methylpiperidine-3-carbonyl)amino]decyl]piperidine-3-carboxamide.
| Compound Name | 1-methyl-N-[10-[(1-methylpiperidine-3-carbonyl)amino]decyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 13300490 |
| Molecular Formula | C24H46N4O2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | 1-methyl-N-[10-[(1-methylpiperidine-3-carbonyl)amino]decyl]piperidine-3-carboxamide |
| SMILES | CN1CCCC(C(=O)NCCCCCCCCCCNC(=O)C2CCCN(C)C2)C1 |
| InChI | InChI=1S/C24H46N4O2/c1-27-17-11-13-21(19-27)23(29)25-15-9-7-5-3-4-6-8-10-16-26-24(30)22-14-12-18-28(2)20-22/h21-22H,3-20H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | WZUIRIKTMVGLDF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|