C20H38N4O2 — CID 13300496
1-methyl-N-[6-[(1-methylpiperidine-3-carbonyl)amino]hexyl]piperidine-3-carboxamide (PubChem CID 13300496) has the molecular formula C20H38N4O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-methyl-N-[6-[(1-methylpiperidine-3-carbonyl)amino]hexyl]piperidine-3-carboxamide.
| Compound Name | 1-methyl-N-[6-[(1-methylpiperidine-3-carbonyl)amino]hexyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 13300496 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 1-methyl-N-[6-[(1-methylpiperidine-3-carbonyl)amino]hexyl]piperidine-3-carboxamide |
| SMILES | CN1CCCC(C(=O)NCCCCCCNC(=O)C2CCCN(C)C2)C1 |
| InChI | InChI=1S/C20H38N4O2/c1-23-13-7-9-17(15-23)19(25)21-11-5-3-4-6-12-22-20(26)18-10-8-14-24(2)16-18/h17-18H,3-16H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | QIMMZGYAVPRQMN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|