C26H16Cl2N2 — CID 13302472
6,12-bis(4-chlorophenyl)benzo[c][1,5]benzodiazocine (PubChem CID 13302472) has the molecular formula C26H16Cl2N2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 6,12-bis(4-chlorophenyl)benzo[c][1,5]benzodiazocine.
| Compound Name | 6,12-bis(4-chlorophenyl)benzo[c][1,5]benzodiazocine |
|---|---|
| PubChem CID | 13302472 |
| Molecular Formula | C26H16Cl2N2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 6,12-bis(4-chlorophenyl)benzo[c][1,5]benzodiazocine |
| SMILES | Clc1ccc(/C2=N/c3ccccc3/C(c3ccc(Cl)cc3)=N\c3ccccc32)cc1 |
| InChI | InChI=1S/C26H16Cl2N2/c27-19-13-9-17(10-14-19)25-21-5-1-3-7-23(21)29-26(18-11-15-20(28)16-12-18)22-6-2-4-8-24(22)30-25/h1-16H/b25-21-,26-22-,29-23-,29-26-,30-24-,30-25- |
| InChIKey | CERNYAMKSNGAMW-GABJPYRJSA-N |
| XLogP | 7.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |