C23H22N4O3 — CID 133053538
3-(benzylamino)-5-(4-morpholin-4-ylfuro[3,2-d]pyrimidin-2-yl)phenol (PubChem CID 133053538) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-(benzylamino)-5-(4-morpholin-4-ylfuro[3,2-d]pyrimidin-2-yl)phenol.
| Compound Name | 3-(benzylamino)-5-(4-morpholin-4-ylfuro[3,2-d]pyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 133053538 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(benzylamino)-5-(4-morpholin-4-ylfuro[3,2-d]pyrimidin-2-yl)phenol |
| SMILES | Oc1cc(NCc2ccccc2)cc(-c2nc(N3CCOCC3)c3occc3n2)c1 |
| InChI | InChI=1S/C23H22N4O3/c28-19-13-17(12-18(14-19)24-15-16-4-2-1-3-5-16)22-25-20-6-9-30-21(20)23(26-22)27-7-10-29-11-8-27/h1-6,9,12-14,24,28H,7-8,10-11,15H2 |
| InChIKey | NOLJEVWXVAGNIQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |