C10H8F6O3S — CID 133054197
[2,2,2-trifluoro-1-(3-methylphenyl)ethyl] trifluoromethanesulfonate (PubChem CID 133054197) has the molecular formula C10H8F6O3S and a molecular weight of 322.23 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(3-methylphenyl)ethyl] trifluoromethanesulfonate.
| Compound Name | [2,2,2-trifluoro-1-(3-methylphenyl)ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 133054197 |
| Molecular Formula | C10H8F6O3S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | [2,2,2-trifluoro-1-(3-methylphenyl)ethyl] trifluoromethanesulfonate |
| SMILES | Cc1cccc(C(OS(=O)(=O)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6O3S/c1-6-3-2-4-7(5-6)8(9(11,12)13)19-20(17,18)10(14,15)16/h2-5,8H,1H3 |
| InChIKey | JPZCHELMQRHAFR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|