C9H7ClN2O — CID 133058495
1-(7-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanone (PubChem CID 133058495) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 1-(7-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanone.
| Compound Name | 1-(7-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 133058495 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 1-(7-chloro-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c2c(Cl)cncc12 |
| InChI | InChI=1S/C9H7ClN2O/c1-5(13)6-3-12-9-7(6)2-11-4-8(9)10/h2-4,12H,1H3 |
| InChIKey | MZISJDLHYASYIN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |