About ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate
ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate (PubChem CID 133060055) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate |
| PubChem CID | 133060055 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(C)cncc12 |
| InChI | InChI=1S/C11H12N2O2/c1-3-15-11(14)9-6-13-10-7(2)4-12-5-8(9)10/h4-6,13H,3H2,1-2H3 |
| InChIKey | OMHOALFUMQDSGM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate?
The IUPAC name of ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate (CID 133060055) is ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate?
The canonical SMILES for ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate is CCOC(=O)c1c[nH]c2c(C)cncc12.
What is the InChIKey of ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate?
The InChIKey is OMHOALFUMQDSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-3-15-11(14)9-6-13-10-7(2)4-12-5-8(9)10/h4-6,13H,3H2,1-2H3.
What are the key properties of ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate?
ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate has a molecular weight of 204.23 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylate is sourced from PubChem (CID 133060055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).