C12H17NO3 — CID 133061882
tert-butyl 2-amino-6-(hydroxymethyl)benzoate (PubChem CID 133061882) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is tert-butyl 2-amino-6-(hydroxymethyl)benzoate.
| Compound Name | tert-butyl 2-amino-6-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 133061882 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | tert-butyl 2-amino-6-(hydroxymethyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1c(N)cccc1CO |
| InChI | InChI=1S/C12H17NO3/c1-12(2,3)16-11(15)10-8(7-14)5-4-6-9(10)13/h4-6,14H,7,13H2,1-3H3 |
| InChIKey | QZFQTFNTCWUXHB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|