C17H14N2O — CID 133064282
4-(4-methylphenyl)-1,4-dihydrochromeno[3,4-d]pyrazole (PubChem CID 133064282) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,4-dihydrochromeno[3,4-d]pyrazole.
| Compound Name | 4-(4-methylphenyl)-1,4-dihydrochromeno[3,4-d]pyrazole |
|---|---|
| PubChem CID | 133064282 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(4-methylphenyl)-1,4-dihydrochromeno[3,4-d]pyrazole |
| SMILES | Cc1ccc(C2Oc3ccccc3-c3[nH]ncc32)cc1 |
| InChI | InChI=1S/C17H14N2O/c1-11-6-8-12(9-7-11)17-14-10-18-19-16(14)13-4-2-3-5-15(13)20-17/h2-10,17H,1H3,(H,18,19) |
| InChIKey | DTPKPSFGFYUZHE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |