C22H17NO — CID 139037249
(1R,9R)-17-(4-methylphenyl)-8-oxa-16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene (PubChem CID 139037249) has the molecular formula C22H17NO and a molecular weight of 311.38 g/mol. Its IUPAC name is (1R,9R)-17-(4-methylphenyl)-8-oxa-16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene.
| Compound Name | (1R,9R)-17-(4-methylphenyl)-8-oxa-16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene |
|---|---|
| PubChem CID | 139037249 |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (1R,9R)-17-(4-methylphenyl)-8-oxa-16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14,16-heptaene |
| SMILES | Cc1ccc(C2=N[C@H]3c4ccccc4O[C@@H]2c2ccccc23)cc1 |
| InChI | InChI=1S/C22H17NO/c1-14-10-12-15(13-11-14)20-22-17-7-3-2-6-16(17)21(23-20)18-8-4-5-9-19(18)24-22/h2-13,21-22H,1H3/t21-,22-/m1/s1 |
| InChIKey | DENMRMJKTRFUQJ-FGZHOGPDSA-N |
| XLogP | 5.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |