C32H39ClN4O4S — CID 133068148
(14S)-14-benzyl-19-chloro-7-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-12,15-dimethyl-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-triene-13,16-dione (PubChem CID 133068148) has the molecular formula C32H39ClN4O4S and a molecular weight of 611.21 g/mol. Its IUPAC name is (14S)-14-benzyl-19-chloro-7-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-12,15-dimethyl-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-triene-13,16-dione.
| Compound Name | (14S)-14-benzyl-19-chloro-7-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-12,15-dimethyl-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-triene-13,16-dione |
|---|---|
| PubChem CID | 133068148 |
| Molecular Formula | C32H39ClN4O4S |
| Molecular Weight | 611.21 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (14S)-14-benzyl-19-chloro-7-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-12,15-dimethyl-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-triene-13,16-dione |
| SMILES | Cc1nc(C)c(C(=O)N2CCCCOc3ccc(Cl)cc3C(=O)N(C)[C@@H](Cc3ccccc3)C(=O)N(C)CCCC2)s1 |
| InChI | InChI=1S/C32H39ClN4O4S/c1-22-29(42-23(2)34-22)32(40)37-17-9-8-16-35(3)31(39)27(20-24-12-6-5-7-13-24)36(4)30(38)26-21-25(33)14-15-28(26)41-19-11-10-18-37/h5-7,12-15,21,27H,8-11,16-20H2,1-4H3/t27-/m0/s1 |
| InChIKey | PZDRXEBYLRLAJY-MHZLTWQESA-N |
| XLogP | 5.65 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.21 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |