C29H39ClN4O6S — CID 133066503
N-[2-[(14S)-14-benzyl-19-chloro-12,15-dimethyl-13,16-dioxo-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-trien-7-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 133066503) has the molecular formula C29H39ClN4O6S and a molecular weight of 607.17 g/mol. Its IUPAC name is N-[2-[(14S)-14-benzyl-19-chloro-12,15-dimethyl-13,16-dioxo-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-trien-7-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-[(14S)-14-benzyl-19-chloro-12,15-dimethyl-13,16-dioxo-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-trien-7-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 133066503 |
| Molecular Formula | C29H39ClN4O6S |
| Molecular Weight | 607.17 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | N-[2-[(14S)-14-benzyl-19-chloro-12,15-dimethyl-13,16-dioxo-2-oxa-7,12,15-triazabicyclo[15.4.0]henicosa-1(17),18,20-trien-7-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | CN1CCCCN(C(=O)CNS(C)(=O)=O)CCCCOc2ccc(Cl)cc2C(=O)N(C)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C29H39ClN4O6S/c1-32-15-7-8-16-34(27(35)21-31-41(3,38)39)17-9-10-18-40-26-14-13-23(30)20-24(26)28(36)33(2)25(29(32)37)19-22-11-5-4-6-12-22/h4-6,11-14,20,25,31H,7-10,15-19,21H2,1-3H3/t25-/m0/s1 |
| InChIKey | XANHGDVLVNPOGJ-VWLOTQADSA-N |
| XLogP | 2.81 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |