C28H30BrN3O3 — CID 133074180
2-(1,3-benzodioxol-5-yl)-1-(6-benzyl-13-bromo-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)ethanone (PubChem CID 133074180) has the molecular formula C28H30BrN3O3 and a molecular weight of 536.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(6-benzyl-13-bromo-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(6-benzyl-13-bromo-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)ethanone |
|---|---|
| PubChem CID | 133074180 |
| Molecular Formula | C28H30BrN3O3 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(6-benzyl-13-bromo-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCN(Cc2ccccc2)CCCNc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C28H30BrN3O3/c29-24-8-9-25-23(17-24)19-32(28(33)16-22-7-10-26-27(15-22)35-20-34-26)14-13-31(12-4-11-30-25)18-21-5-2-1-3-6-21/h1-3,5-10,15,17,30H,4,11-14,16,18-20H2 |
| InChIKey | YYDFTWCWHXAYTA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |