C16H13FN6O2S — CID 1330757
4-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide (PubChem CID 1330757) has the molecular formula C16H13FN6O2S and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide.
| Compound Name | 4-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 1330757 |
| Molecular Formula | C16H13FN6O2S |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nnnc2SCC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C16H13FN6O2S/c17-12-3-1-2-4-13(12)19-14(24)9-26-16-20-21-22-23(16)11-7-5-10(6-8-11)15(18)25/h1-8H,9H2,(H2,18,25)(H,19,24) |
| InChIKey | GXRLWAAFJNSHHQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |