C15H12FN5OS — CID 661053
4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide (PubChem CID 661053) has the molecular formula C15H12FN5OS and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide.
| Compound Name | 4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 661053 |
| Molecular Formula | C15H12FN5OS |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nnnc2SCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H12FN5OS/c16-12-5-1-10(2-6-12)9-23-15-18-19-20-21(15)13-7-3-11(4-8-13)14(17)22/h1-8H,9H2,(H2,17,22) |
| InChIKey | STKRHDHWGOTREV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |