C20H18N8O3S — CID 4856320
2-cyano-N-[4-[[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]carbamoyl]phenyl]acetamide (PubChem CID 4856320) has the molecular formula C20H18N8O3S and a molecular weight of 450.48 g/mol. Its IUPAC name is 2-cyano-N-[4-[[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]carbamoyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4856320 |
| Molecular Formula | C20H18N8O3S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-cyano-N-[4-[[[2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]carbamoyl]phenyl]acetamide |
| SMILES | Cc1ccccc1-n1nnnc1SCC(=O)NNC(=O)c1ccc(NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C20H18N8O3S/c1-13-4-2-3-5-16(13)28-20(25-26-27-28)32-12-18(30)23-24-19(31)14-6-8-15(9-7-14)22-17(29)10-11-21/h2-9H,10,12H2,1H3,(H,22,29)(H,23,30)(H,24,31) |
| InChIKey | VYWITFITMUKJIC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|