C30H46N6O6 — CID 133075818
(4S,7R,10S,14S)-4-methyl-14-(4-methyl-1,4-diazepane-1-carbonyl)-7,10-di(propan-2-yl)-2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-6,9,12,16-tetrone (PubChem CID 133075818) has the molecular formula C30H46N6O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is (4S,7R,10S,14S)-4-methyl-14-(4-methyl-1,4-diazepane-1-carbonyl)-7,10-di(propan-2-yl)-2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-6,9,12,16-tetrone.
| Compound Name | (4S,7R,10S,14S)-4-methyl-14-(4-methyl-1,4-diazepane-1-carbonyl)-7,10-di(propan-2-yl)-2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-6,9,12,16-tetrone |
|---|---|
| PubChem CID | 133075818 |
| Molecular Formula | C30H46N6O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (4S,7R,10S,14S)-4-methyl-14-(4-methyl-1,4-diazepane-1-carbonyl)-7,10-di(propan-2-yl)-2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-6,9,12,16-tetrone |
| SMILES | CC(C)[C@@H]1NC(=O)C[C@@H](C(=O)N2CCCN(C)CC2)NC(=O)c2ccccc2OC[C@H](C)NC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C30H46N6O6/c1-18(2)25-29(40)34-26(19(3)4)28(39)31-20(5)17-42-23-11-8-7-10-21(23)27(38)32-22(16-24(37)33-25)30(41)36-13-9-12-35(6)14-15-36/h7-8,10-11,18-20,22,25-26H,9,12-17H2,1-6H3,(H,31,39)(H,32,38)(H,33,37)(H,34,40)/t20-,22-,25-,26+/m0/s1 |
| InChIKey | HBYBIWPNHNOJLX-LHVUSNKQSA-N |
| XLogP | 0.52 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |