C31H39N5O6 — CID 133074489
(4R,10S,14S)-10-[(4-hydroxyphenyl)methyl]-14-(4-methyl-1,4-diazepane-1-carbonyl)-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-9,12,16-trione (PubChem CID 133074489) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is (4R,10S,14S)-10-[(4-hydroxyphenyl)methyl]-14-(4-methyl-1,4-diazepane-1-carbonyl)-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-9,12,16-trione.
| Compound Name | (4R,10S,14S)-10-[(4-hydroxyphenyl)methyl]-14-(4-methyl-1,4-diazepane-1-carbonyl)-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-9,12,16-trione |
|---|---|
| PubChem CID | 133074489 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | (4R,10S,14S)-10-[(4-hydroxyphenyl)methyl]-14-(4-methyl-1,4-diazepane-1-carbonyl)-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-9,12,16-trione |
| SMILES | CN1CCCN(C(=O)[C@@H]2CC(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N3CCC[C@@H]3COc3ccccc3C(=O)N2)CC1 |
| InChI | InChI=1S/C31H39N5O6/c1-34-13-5-14-35(17-16-34)30(40)26-19-28(38)32-25(18-21-9-11-23(37)12-10-21)31(41)36-15-4-6-22(36)20-42-27-8-3-2-7-24(27)29(39)33-26/h2-3,7-12,22,25-26,37H,4-6,13-20H2,1H3,(H,32,38)(H,33,39)/t22-,25+,26+/m1/s1 |
| InChIKey | IYAFSGFBHJPUAJ-RZFJZAQRSA-N |
| XLogP | 1.16 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |