C30H47N5O5 — CID 133076726
(4R,12S)-N-[4-(dimethylamino)butyl]-6,9,14-trioxo-4-propan-2-ylspiro[2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-7,1'-cyclohexane]-12-carboxamide (PubChem CID 133076726) has the molecular formula C30H47N5O5 and a molecular weight of 557.74 g/mol. Its IUPAC name is (4R,12S)-N-[4-(dimethylamino)butyl]-6,9,14-trioxo-4-propan-2-ylspiro[2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-7,1'-cyclohexane]-12-carboxamide.
| Compound Name | (4R,12S)-N-[4-(dimethylamino)butyl]-6,9,14-trioxo-4-propan-2-ylspiro[2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-7,1'-cyclohexane]-12-carboxamide |
|---|---|
| PubChem CID | 133076726 |
| Molecular Formula | C30H47N5O5 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | (4R,12S)-N-[4-(dimethylamino)butyl]-6,9,14-trioxo-4-propan-2-ylspiro[2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-7,1'-cyclohexane]-12-carboxamide |
| SMILES | CC(C)[C@@H]1COc2ccccc2C(=O)N[C@H](C(=O)NCCCCN(C)C)CCC(=O)NC2(CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C30H47N5O5/c1-21(2)24-20-40-25-13-7-6-12-22(25)27(37)32-23(28(38)31-18-10-11-19-35(3)4)14-15-26(36)34-30(29(39)33-24)16-8-5-9-17-30/h6-7,12-13,21,23-24H,5,8-11,14-20H2,1-4H3,(H,31,38)(H,32,37)(H,33,39)(H,34,36)/t23-,24-/m0/s1 |
| InChIKey | RIGJBDNTSDPINA-ZEQRLZLVSA-N |
| XLogP | 2.38 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|