C31H48N6O6 — CID 133076031
(7R,14S)-N-[4-(dimethylamino)butyl]-6,9,12,16-tetraoxo-7-propan-2-ylspiro[2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-10,1'-cyclohexane]-14-carboxamide (PubChem CID 133076031) has the molecular formula C31H48N6O6 and a molecular weight of 600.76 g/mol. Its IUPAC name is (7R,14S)-N-[4-(dimethylamino)butyl]-6,9,12,16-tetraoxo-7-propan-2-ylspiro[2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-10,1'-cyclohexane]-14-carboxamide.
| Compound Name | (7R,14S)-N-[4-(dimethylamino)butyl]-6,9,12,16-tetraoxo-7-propan-2-ylspiro[2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-10,1'-cyclohexane]-14-carboxamide |
|---|---|
| PubChem CID | 133076031 |
| Molecular Formula | C31H48N6O6 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | (7R,14S)-N-[4-(dimethylamino)butyl]-6,9,12,16-tetraoxo-7-propan-2-ylspiro[2-oxa-5,8,11,15-tetrazabicyclo[15.4.0]henicosa-1(21),17,19-triene-10,1'-cyclohexane]-14-carboxamide |
| SMILES | CC(C)[C@H]1NC(=O)C2(CCCCC2)NC(=O)C[C@@H](C(=O)NCCCCN(C)C)NC(=O)c2ccccc2OCCNC1=O |
| InChI | InChI=1S/C31H48N6O6/c1-21(2)26-29(41)33-17-19-43-24-13-7-6-12-22(24)27(39)34-23(28(40)32-16-10-11-18-37(3)4)20-25(38)36-31(30(42)35-26)14-8-5-9-15-31/h6-7,12-13,21,23,26H,5,8-11,14-20H2,1-4H3,(H,32,40)(H,33,41)(H,34,39)(H,35,42)(H,36,38)/t23-,26+/m0/s1 |
| InChIKey | RJVJWOZDLAZJIE-JYFHCDHNSA-N |
| XLogP | 1.10 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|