C19H23N3O6 — CID 110164200
(11S)-6,9,13-trioxospiro[2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,1'-cyclopentane]-11-carboxylic acid (PubChem CID 110164200) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is (11S)-6,9,13-trioxospiro[2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,1'-cyclopentane]-11-carboxylic acid.
| Compound Name | (11S)-6,9,13-trioxospiro[2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,1'-cyclopentane]-11-carboxylic acid |
|---|---|
| PubChem CID | 110164200 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (11S)-6,9,13-trioxospiro[2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,1'-cyclopentane]-11-carboxylic acid |
| SMILES | O=C1C[C@@H](C(=O)O)NC(=O)c2ccccc2OCCNC(=O)C2(CCCC2)N1 |
| InChI | InChI=1S/C19H23N3O6/c23-15-11-13(17(25)26)21-16(24)12-5-1-2-6-14(12)28-10-9-20-18(27)19(22-15)7-3-4-8-19/h1-2,5-6,13H,3-4,7-11H2,(H,20,27)(H,21,24)(H,22,23)(H,25,26)/t13-/m0/s1 |
| InChIKey | IQVNSPHFNHXYDS-ZDUSSCGKSA-N |
| XLogP | 0.20 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |