About 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate
4-cyclopenta-2,4-dien-1-ylidenepentyl acetate (PubChem CID 13307745) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate.
Molecular Properties
| Compound Name | 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate |
| PubChem CID | 13307745 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate |
| SMILES | CC(=O)OCCCC(C)=C1C=CC=C1 |
| InChI | InChI=1S/C12H16O2/c1-10(12-7-3-4-8-12)6-5-9-14-11(2)13/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | JVKOQXYNWGANEL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate?
The IUPAC name of 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate (CID 13307745) is 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate.
What is the SMILES notation for 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate?
The canonical SMILES for 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate is CC(=O)OCCCC(C)=C1C=CC=C1.
What is the InChIKey of 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate?
The InChIKey is JVKOQXYNWGANEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-10(12-7-3-4-8-12)6-5-9-14-11(2)13/h3-4,7-8H,5-6,9H2,1-2H3.
What are the key properties of 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate?
4-cyclopenta-2,4-dien-1-ylidenepentyl acetate has a molecular weight of 192.26 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-2,4-dien-1-ylidenepentyl acetate is sourced from PubChem (CID 13307745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).