C26H37F3N2O3 — CID 133079452
(3S,8R)-17-ethyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one (PubChem CID 133079452) has the molecular formula C26H37F3N2O3 and a molecular weight of 482.59 g/mol. Its IUPAC name is (3S,8R)-17-ethyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3S,8R)-17-ethyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 133079452 |
| Molecular Formula | C26H37F3N2O3 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | (3S,8R)-17-ethyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
| SMILES | CCN1CCCCCCCN(C(=O)CCC(F)(F)F)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C26H37F3N2O3/c1-2-30-18-10-4-3-5-11-19-31(24(32)16-17-26(27,28)29)21-13-7-9-15-23(21)34-22-14-8-6-12-20(22)25(30)33/h6,8,12,14,21,23H,2-5,7,9-11,13,15-19H2,1H3/t21-,23+/m1/s1 |
| InChIKey | LLFBUGXCBSYJGQ-GGAORHGYSA-N |
| XLogP | 5.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |