C27H42N2O3 — CID 133080296
(3S,8R)-9-(3,3-dimethylbutanoyl)-16-ethyl-2-oxa-9,16-diazatricyclo[16.4.0.03,8]docosa-1(22),18,20-trien-17-one (PubChem CID 133080296) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is (3S,8R)-9-(3,3-dimethylbutanoyl)-16-ethyl-2-oxa-9,16-diazatricyclo[16.4.0.03,8]docosa-1(22),18,20-trien-17-one.
| Compound Name | (3S,8R)-9-(3,3-dimethylbutanoyl)-16-ethyl-2-oxa-9,16-diazatricyclo[16.4.0.03,8]docosa-1(22),18,20-trien-17-one |
|---|---|
| PubChem CID | 133080296 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (3S,8R)-9-(3,3-dimethylbutanoyl)-16-ethyl-2-oxa-9,16-diazatricyclo[16.4.0.03,8]docosa-1(22),18,20-trien-17-one |
| SMILES | CCN1CCCCCCN(C(=O)CC(C)(C)C)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C27H42N2O3/c1-5-28-18-12-6-7-13-19-29(25(30)20-27(2,3)4)22-15-9-11-17-24(22)32-23-16-10-8-14-21(23)26(28)31/h8,10,14,16,22,24H,5-7,9,11-13,15,17-20H2,1-4H3/t22-,24+/m1/s1 |
| InChIKey | RPFCBLWFJWCIMH-VWNXMTODSA-N |
| XLogP | 5.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |