C23H37N5O — CID 133081504
5-ethyl-3-(4-octylphenyl)-1,2,4-oxadiazole;pyrrolidine-1-carboximidamide (PubChem CID 133081504) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is 5-ethyl-3-(4-octylphenyl)-1,2,4-oxadiazole;pyrrolidine-1-carboximidamide.
| Compound Name | 5-ethyl-3-(4-octylphenyl)-1,2,4-oxadiazole;pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 133081504 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 5-ethyl-3-(4-octylphenyl)-1,2,4-oxadiazole;pyrrolidine-1-carboximidamide |
| SMILES | CCCCCCCCc1ccc(-c2noc(CC)n2)cc1.[H]/N=C(\N)N1CCCC1 |
| InChI | InChI=1S/C18H26N2O.C5H11N3/c1-3-5-6-7-8-9-10-15-11-13-16(14-12-15)18-19-17(4-2)21-20-18;6-5(7)8-3-1-2-4-8/h11-14H,3-10H2,1-2H3;1-4H2,(H3,6,7) |
| InChIKey | IURDGHBSNDDQDI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|