C7H11NO3S — CID 133083544
(2R)-2-amino-2-formyl-3-(methylsulfanylmethyl)but-3-enoic acid (PubChem CID 133083544) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is (2R)-2-amino-2-formyl-3-(methylsulfanylmethyl)but-3-enoic acid.
| Compound Name | (2R)-2-amino-2-formyl-3-(methylsulfanylmethyl)but-3-enoic acid |
|---|---|
| PubChem CID | 133083544 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (2R)-2-amino-2-formyl-3-(methylsulfanylmethyl)but-3-enoic acid |
| SMILES | C=C(CSC)[C@@](N)(C=O)C(=O)O |
| InChI | InChI=1S/C7H11NO3S/c1-5(3-12-2)7(8,4-9)6(10)11/h4H,1,3,8H2,2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | WZRFIPHWGYJCRI-ZETCQYMHSA-N |
| XLogP | -0.11 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|