C33H36N4O5S — CID 133084060
(2S,3S)-N-benzyl-2-hydroxy-4-[(3S)-2-oxopyrrolidin-3-yl]-3-[[(2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-sulfanylbutanamide (PubChem CID 133084060) has the molecular formula C33H36N4O5S and a molecular weight of 600.74 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-2-hydroxy-4-[(3S)-2-oxopyrrolidin-3-yl]-3-[[(2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-sulfanylbutanamide.
| Compound Name | (2S,3S)-N-benzyl-2-hydroxy-4-[(3S)-2-oxopyrrolidin-3-yl]-3-[[(2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 133084060 |
| Molecular Formula | C33H36N4O5S |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | (2S,3S)-N-benzyl-2-hydroxy-4-[(3S)-2-oxopyrrolidin-3-yl]-3-[[(2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-sulfanylbutanamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)[C@](O)(S)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H36N4O5S/c38-29(17-16-23-10-4-1-5-11-23)36-27(20-24-12-6-2-7-13-24)31(40)37-28(21-26-18-19-34-30(26)39)33(42,43)32(41)35-22-25-14-8-3-9-15-25/h1-17,26-28,42-43H,18-22H2,(H,34,39)(H,35,41)(H,36,38)(H,37,40)/b17-16+/t26-,27-,28-,33-/m0/s1 |
| InChIKey | SKJVZBGYUNIYQZ-NLVYYTPISA-N |
| XLogP | 2.37 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|