C26H28FN3O4 — CID 72700618
(2S)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]-3-phenylpropanamide (PubChem CID 72700618) has the molecular formula C26H28FN3O4 and a molecular weight of 465.53 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 72700618 |
| Molecular Formula | C26H28FN3O4 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (2S)-2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]-3-phenylpropanamide |
| SMILES | O=C[C@H](CC1CCCNC1=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN3O4/c27-21-11-8-18(9-12-21)10-13-24(32)30-23(15-19-5-2-1-3-6-19)26(34)29-22(17-31)16-20-7-4-14-28-25(20)33/h1-3,5-6,8-13,17,20,22-23H,4,7,14-16H2,(H,28,33)(H,29,34)(H,30,32)/b13-10+/t20?,22-,23-/m0/s1 |
| InChIKey | CREBUPLDOVFQLH-LPGAFXCFSA-N |
| XLogP | 2.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|