C24H26FN3O4 — CID 72700176
N-[3-(4-fluorophenyl)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]propan-2-yl]benzamide (PubChem CID 72700176) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]propan-2-yl]benzamide.
| Compound Name | N-[3-(4-fluorophenyl)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 72700176 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[3-(4-fluorophenyl)-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]propan-2-yl]benzamide |
| SMILES | O=C[C@H](C[C@@H]1CCCNC1=O)NC(=O)C(Cc1ccc(F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26FN3O4/c25-19-10-8-16(9-11-19)13-21(28-23(31)17-5-2-1-3-6-17)24(32)27-20(15-29)14-18-7-4-12-26-22(18)30/h1-3,5-6,8-11,15,18,20-21H,4,7,12-14H2,(H,26,30)(H,27,32)(H,28,31)/t18-,20-,21?/m0/s1 |
| InChIKey | ZTEQFMUNPCIWOC-WZENJKSDSA-N |
| XLogP | 1.77 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|