C29H36FN3O5S — CID 72694325
tert-butyl (3R)-3-[[(2S)-2-benzamido-3-(4-fluorophenyl)propanoyl]amino]-4-[(3S)-2-oxopiperidin-3-yl]-2-sulfanylbutanoate (PubChem CID 72694325) has the molecular formula C29H36FN3O5S and a molecular weight of 557.69 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(2S)-2-benzamido-3-(4-fluorophenyl)propanoyl]amino]-4-[(3S)-2-oxopiperidin-3-yl]-2-sulfanylbutanoate.
| Compound Name | tert-butyl (3R)-3-[[(2S)-2-benzamido-3-(4-fluorophenyl)propanoyl]amino]-4-[(3S)-2-oxopiperidin-3-yl]-2-sulfanylbutanoate |
|---|---|
| PubChem CID | 72694325 |
| Molecular Formula | C29H36FN3O5S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | tert-butyl (3R)-3-[[(2S)-2-benzamido-3-(4-fluorophenyl)propanoyl]amino]-4-[(3S)-2-oxopiperidin-3-yl]-2-sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(S)[C@@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36FN3O5S/c1-29(2,3)38-28(37)24(39)22(17-20-10-7-15-31-25(20)34)32-27(36)23(16-18-11-13-21(30)14-12-18)33-26(35)19-8-5-4-6-9-19/h4-6,8-9,11-14,20,22-24,39H,7,10,15-17H2,1-3H3,(H,31,34)(H,32,36)(H,33,35)/t20-,22+,23-,24?/m0/s1 |
| InChIKey | IVGOWBIHJKVQLQ-GKXQJSAQSA-N |
| XLogP | 3.21 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|