C29H42N4O5 — CID 162515897
(2S)-2-[[(2S)-3,3-dimethyl-2-(3-phenylprop-2-enoylamino)butanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide (PubChem CID 162515897) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3,3-dimethyl-2-(3-phenylprop-2-enoylamino)butanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-3,3-dimethyl-2-(3-phenylprop-2-enoylamino)butanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 162515897 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | (2S)-2-[[(2S)-3,3-dimethyl-2-(3-phenylprop-2-enoylamino)butanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)C=Cc1ccccc1)C(C)(C)C)C(=O)N[C@H](C=O)C[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C29H42N4O5/c1-19(2)16-23(27(37)31-22(18-34)17-21-12-9-15-30-26(21)36)32-28(38)25(29(3,4)5)33-24(35)14-13-20-10-7-6-8-11-20/h6-8,10-11,13-14,18-19,21-23,25H,9,12,15-17H2,1-5H3,(H,30,36)(H,31,37)(H,32,38)(H,33,35)/t21-,22-,23-,25+/m0/s1 |
| InChIKey | ARBHUFVDURZZOB-KELBGUDLSA-N |
| XLogP | 2.36 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|