C29H39F3N4O6 — CID 169122626
(2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]-4-methylpentanamide (PubChem CID 169122626) has the molecular formula C29H39F3N4O6 and a molecular weight of 596.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 169122626 |
| Molecular Formula | C29H39F3N4O6 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-N-[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C(=O)NC(CC1CCCNC1=O)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H39F3N4O6/c1-16(2)14-20(35-26(41)23(28(3,4)5)36-27(42)29(30,31)32)25(40)34-19(15-18-12-9-13-33-24(18)39)22(38)21(37)17-10-7-6-8-11-17/h6-8,10-11,16,18-20,23H,9,12-15H2,1-5H3,(H,33,39)(H,34,40)(H,35,41)(H,36,42)/t18?,19?,20-,23+/m0/s1 |
| InChIKey | CLSPYKSMXUESRC-SQKGIWRMSA-N |
| XLogP | 2.46 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|