C34H42N4O6 — CID 169122585
N-[(2S)-1-[[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-7-methoxy-1,2,3,4-tetrahydro-1-benzazocine-6-carboxamide (PubChem CID 169122585) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is N-[(2S)-1-[[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-7-methoxy-1,2,3,4-tetrahydro-1-benzazocine-6-carboxamide.
| Compound Name | N-[(2S)-1-[[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-7-methoxy-1,2,3,4-tetrahydro-1-benzazocine-6-carboxamide |
|---|---|
| PubChem CID | 169122585 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | N-[(2S)-1-[[3,4-dioxo-1-(2-oxopiperidin-3-yl)-4-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-7-methoxy-1,2,3,4-tetrahydro-1-benzazocine-6-carboxamide |
| SMILES | COc1cccc2c1C(C(=O)N[C@@H](CC(C)C)C(=O)NC(CC1CCCNC1=O)C(=O)C(=O)c1ccccc1)=CCCCN2 |
| InChI | InChI=1S/C34H42N4O6/c1-21(2)19-27(38-33(42)24-14-7-8-17-35-25-15-9-16-28(44-3)29(24)25)34(43)37-26(20-23-13-10-18-36-32(23)41)31(40)30(39)22-11-5-4-6-12-22/h4-6,9,11-12,14-16,21,23,26-27,35H,7-8,10,13,17-20H2,1-3H3,(H,36,41)(H,37,43)(H,38,42)/t23?,26?,27-/m0/s1 |
| InChIKey | FRIMNTGLPVYICF-YTZIBCIGSA-N |
| XLogP | 3.67 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|