C12H7F5N2 — CID 133086498
5-methyl-6-(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine (PubChem CID 133086498) has the molecular formula C12H7F5N2 and a molecular weight of 274.19 g/mol. Its IUPAC name is 5-methyl-6-(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine.
| Compound Name | 5-methyl-6-(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133086498 |
| Molecular Formula | C12H7F5N2 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-methyl-6-(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine |
| SMILES | Cc1cc(N)cnc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H7F5N2/c1-4-2-5(18)3-19-12(4)6-7(13)9(15)11(17)10(16)8(6)14/h2-3H,18H2,1H3 |
| InChIKey | NMWUOIWLOLGJMJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|