C17H4F10N2 — CID 133086452
2,5-bis(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine (PubChem CID 133086452) has the molecular formula C17H4F10N2 and a molecular weight of 426.21 g/mol. Its IUPAC name is 2,5-bis(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine.
| Compound Name | 2,5-bis(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133086452 |
| Molecular Formula | C17H4F10N2 |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2,5-bis(2,3,4,5,6-pentafluorophenyl)pyridin-3-amine |
| SMILES | Nc1cc(-c2c(F)c(F)c(F)c(F)c2F)cnc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H4F10N2/c18-7-5(8(19)12(23)15(26)11(7)22)3-1-4(28)17(29-2-3)6-9(20)13(24)16(27)14(25)10(6)21/h1-2H,28H2 |
| InChIKey | GMNMWQVZJTZPKH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|