C11H12N4 — CID 144882064
4-(6-amino-3-pyridinyl)benzene-1,2-diamine (PubChem CID 144882064) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(6-amino-3-pyridinyl)benzene-1,2-diamine.
| Compound Name | 4-(6-amino-3-pyridinyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 144882064 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 4-(6-amino-3-pyridinyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(-c2ccc(N)c(N)c2)cn1 |
| InChI | InChI=1S/C11H12N4/c12-9-3-1-7(5-10(9)13)8-2-4-11(14)15-6-8/h1-6H,12-13H2,(H2,14,15) |
| InChIKey | JIDIEYSDYZDLSX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|