C10H6BrF6NO3 — CID 133087735
methyl 2-[6-bromo-5-(trifluoromethoxy)-4-(trifluoromethyl)-3-pyridinyl]acetate (PubChem CID 133087735) has the molecular formula C10H6BrF6NO3 and a molecular weight of 382.05 g/mol. Its IUPAC name is methyl 2-[6-bromo-5-(trifluoromethoxy)-4-(trifluoromethyl)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[6-bromo-5-(trifluoromethoxy)-4-(trifluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133087735 |
| Molecular Formula | C10H6BrF6NO3 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | methyl 2-[6-bromo-5-(trifluoromethoxy)-4-(trifluoromethyl)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(Br)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H6BrF6NO3/c1-20-5(19)2-4-3-18-8(11)7(21-10(15,16)17)6(4)9(12,13)14/h3H,2H2,1H3 |
| InChIKey | TVBQDNBQLVBLMH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|