C10H7F6NO2 — CID 133103864
methyl 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate (PubChem CID 133103864) has the molecular formula C10H7F6NO2 and a molecular weight of 287.16 g/mol. Its IUPAC name is methyl 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133103864 |
| Molecular Formula | C10H7F6NO2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | methyl 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(C(F)F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C10H7F6NO2/c1-19-5(18)2-4-3-17-8(9(12)13)6(7(4)11)10(14,15)16/h3,9H,2H2,1H3 |
| InChIKey | UUPXUFRXCPCIST-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |