C13H9ClN2 — CID 133087909
6-chloro-4-phenyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 133087909) has the molecular formula C13H9ClN2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 6-chloro-4-phenyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-chloro-4-phenyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 133087909 |
| Molecular Formula | C13H9ClN2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 6-chloro-4-phenyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cc(-c2ccccc2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C13H9ClN2/c14-12-8-11(9-4-2-1-3-5-9)10-6-7-15-13(10)16-12/h1-8H,(H,15,16) |
| InChIKey | WTEZDMJXXUWONO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|