C25H17NS — CID 13308806
2-isothiocyanato-1,3,5-triphenylbenzene (PubChem CID 13308806) has the molecular formula C25H17NS and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-isothiocyanato-1,3,5-triphenylbenzene.
| Compound Name | 2-isothiocyanato-1,3,5-triphenylbenzene |
|---|---|
| PubChem CID | 13308806 |
| Molecular Formula | C25H17NS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-isothiocyanato-1,3,5-triphenylbenzene |
| SMILES | S=C=Nc1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H17NS/c27-18-26-25-23(20-12-6-2-7-13-20)16-22(19-10-4-1-5-11-19)17-24(25)21-14-8-3-9-15-21/h1-17H |
| InChIKey | AFJYTKBKRWQAEP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|