C13H8Cl2FNO2 — CID 133090667
methyl 6-(2,5-dichlorophenyl)-3-fluoropyridine-2-carboxylate (PubChem CID 133090667) has the molecular formula C13H8Cl2FNO2 and a molecular weight of 300.12 g/mol. Its IUPAC name is methyl 6-(2,5-dichlorophenyl)-3-fluoropyridine-2-carboxylate.
| Compound Name | methyl 6-(2,5-dichlorophenyl)-3-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 133090667 |
| Molecular Formula | C13H8Cl2FNO2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | methyl 6-(2,5-dichlorophenyl)-3-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cc(Cl)ccc2Cl)ccc1F |
| InChI | InChI=1S/C13H8Cl2FNO2/c1-19-13(18)12-10(16)4-5-11(17-12)8-6-7(14)2-3-9(8)15/h2-6H,1H3 |
| InChIKey | GDOQFNNOCQRORK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |