C13H10F3NO3 — CID 133091674
5-(hydroxymethyl)-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one (PubChem CID 133091674) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one.
| Compound Name | 5-(hydroxymethyl)-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133091674 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-(hydroxymethyl)-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(CO)cc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)20-10-3-1-2-9(5-10)11-4-8(7-18)6-17-12(11)19/h1-6,18H,7H2,(H,17,19) |
| InChIKey | WFRNNAYSTRATOG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |