C14H10F3NO4 — CID 133091653
2-[2-oxo-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-4-yl]acetic acid (PubChem CID 133091653) has the molecular formula C14H10F3NO4 and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-[2-oxo-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-4-yl]acetic acid.
| Compound Name | 2-[2-oxo-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-4-yl]acetic acid |
|---|---|
| PubChem CID | 133091653 |
| Molecular Formula | C14H10F3NO4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[2-oxo-3-[3-(trifluoromethoxy)phenyl]-1H-pyridin-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cc[nH]c(=O)c1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NO4/c15-14(16,17)22-10-3-1-2-8(6-10)12-9(7-11(19)20)4-5-18-13(12)21/h1-6H,7H2,(H,18,21)(H,19,20) |
| InChIKey | COBKAMSQSBUPNR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |