C14H9ClF3NO3 — CID 119017945
2-[2-chloro-6-[3-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid (PubChem CID 119017945) has the molecular formula C14H9ClF3NO3 and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-[2-chloro-6-[3-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-chloro-6-[3-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119017945 |
| Molecular Formula | C14H9ClF3NO3 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-[2-chloro-6-[3-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cl)nc(-c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H9ClF3NO3/c15-12-5-8(6-13(20)21)4-11(19-12)9-2-1-3-10(7-9)22-14(16,17)18/h1-5,7H,6H2,(H,20,21) |
| InChIKey | NBJGUFLZUVMUEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|