C14H9F3N2O — CID 133092012
2-[2-oxo-5-[3-(trifluoromethyl)phenyl]-1H-pyridin-4-yl]acetonitrile (PubChem CID 133092012) has the molecular formula C14H9F3N2O and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-[2-oxo-5-[3-(trifluoromethyl)phenyl]-1H-pyridin-4-yl]acetonitrile.
| Compound Name | 2-[2-oxo-5-[3-(trifluoromethyl)phenyl]-1H-pyridin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 133092012 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[2-oxo-5-[3-(trifluoromethyl)phenyl]-1H-pyridin-4-yl]acetonitrile |
| SMILES | N#CCc1cc(=O)[nH]cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F3N2O/c15-14(16,17)11-3-1-2-9(6-11)12-8-19-13(20)7-10(12)4-5-18/h1-3,6-8H,4H2,(H,19,20) |
| InChIKey | QZDCHZRJYICQPU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |