C12H6Cl3NO3 — CID 133092325
2-oxo-5-(3,4,5-trichlorophenyl)-1H-pyridine-4-carboxylic acid (PubChem CID 133092325) has the molecular formula C12H6Cl3NO3 and a molecular weight of 318.54 g/mol. Its IUPAC name is 2-oxo-5-(3,4,5-trichlorophenyl)-1H-pyridine-4-carboxylic acid.
| Compound Name | 2-oxo-5-(3,4,5-trichlorophenyl)-1H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 133092325 |
| Molecular Formula | C12H6Cl3NO3 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2-oxo-5-(3,4,5-trichlorophenyl)-1H-pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)[nH]cc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H6Cl3NO3/c13-8-1-5(2-9(14)11(8)15)7-4-16-10(17)3-6(7)12(18)19/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | PQTMJTHMIXHOKG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|