C13H11NO4 — CID 53222732
5-[2-(hydroxymethyl)phenyl]-2-oxo-1H-pyridine-4-carboxylic acid (PubChem CID 53222732) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 5-[2-(hydroxymethyl)phenyl]-2-oxo-1H-pyridine-4-carboxylic acid.
| Compound Name | 5-[2-(hydroxymethyl)phenyl]-2-oxo-1H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 53222732 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-[2-(hydroxymethyl)phenyl]-2-oxo-1H-pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)[nH]cc1-c1ccccc1CO |
| InChI | InChI=1S/C13H11NO4/c15-7-8-3-1-2-4-9(8)11-6-14-12(16)5-10(11)13(17)18/h1-6,15H,7H2,(H,14,16)(H,17,18) |
| InChIKey | RIXROZVHMUKZEB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |